About N-ethyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine
N-ethyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106775077) has the molecular formula C10H9F3N4S2
and a molecular weight of 306.34 g/mol. Its IUPAC name is N-ethyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-ethyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine |
| PubChem CID | 106775077 |
| Molecular Formula | C10H9F3N4S2 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | N-ethyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CCNc1cc(Sc2nccs2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H9F3N4S2/c1-2-14-6-5-7(19-9-15-3-4-18-9)17-8(16-6)10(11,12)13/h3-5H,2H2,1H3,(H,14,16,17) |
| InChIKey | KZWMYHVTRLMIID-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine?
The IUPAC name of N-ethyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine (CID 106775077) is N-ethyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine.
What is the SMILES notation for N-ethyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine?
The canonical SMILES for N-ethyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine is CCNc1cc(Sc2nccs2)nc(C(F)(F)F)n1.
What is the InChIKey of N-ethyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine?
The InChIKey is KZWMYHVTRLMIID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3N4S2/c1-2-14-6-5-7(19-9-15-3-4-18-9)17-8(16-6)10(11,12)13/h3-5H,2H2,1H3,(H,14,16,17).
What are the key properties of N-ethyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine?
N-ethyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine has a molecular weight of 306.34 g/mol, XLogP of 3.53, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine is sourced from PubChem (CID 106775077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).