C10H8F3N5S — CID 106775121
6-(4-methylpyrimidin-2-yl)sulfanyl-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106775121) has the molecular formula C10H8F3N5S and a molecular weight of 287.27 g/mol. Its IUPAC name is 6-(4-methylpyrimidin-2-yl)sulfanyl-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-(4-methylpyrimidin-2-yl)sulfanyl-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106775121 |
| Molecular Formula | C10H8F3N5S |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 6-(4-methylpyrimidin-2-yl)sulfanyl-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Cc1ccnc(Sc2cc(N)nc(C(F)(F)F)n2)n1 |
| InChI | InChI=1S/C10H8F3N5S/c1-5-2-3-15-9(16-5)19-7-4-6(14)17-8(18-7)10(11,12)13/h2-4H,1H3,(H2,14,17,18) |
| InChIKey | RIQAYZNUCQOUAN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |