C10H11F3N8 — CID 106775768
[6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-(trifluoromethyl)pyrimidin-4-yl]hydrazine (PubChem CID 106775768) has the molecular formula C10H11F3N8 and a molecular weight of 300.25 g/mol. Its IUPAC name is [6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-(trifluoromethyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-(trifluoromethyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 106775768 |
| Molecular Formula | C10H11F3N8 |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | [6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-(trifluoromethyl)pyrimidin-4-yl]hydrazine |
| SMILES | NNc1cc(N2CCn3cnnc3C2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H11F3N8/c11-10(12,13)9-16-6(18-14)3-7(17-9)20-1-2-21-5-15-19-8(21)4-20/h3,5H,1-2,4,14H2,(H,16,17,18) |
| InChIKey | VFFUKMWILVJIJO-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|