C9H10F3N7 — CID 106776277
[6-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-(trifluoromethyl)pyrimidin-4-yl]hydrazine (PubChem CID 106776277) has the molecular formula C9H10F3N7 and a molecular weight of 273.22 g/mol. Its IUPAC name is [6-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-(trifluoromethyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [6-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-(trifluoromethyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 106776277 |
| Molecular Formula | C9H10F3N7 |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | [6-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-(trifluoromethyl)pyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(C)n(-c2cc(NN)nc(C(F)(F)F)n2)n1 |
| InChI | InChI=1S/C9H10F3N7/c1-4-14-5(2)19(18-4)7-3-6(17-13)15-8(16-7)9(10,11)12/h3H,13H2,1-2H3,(H,15,16,17) |
| InChIKey | QRNAGIJQGXNYIY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|