C12H8F3N5O — CID 106776357
2-[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]oxybenzonitrile (PubChem CID 106776357) has the molecular formula C12H8F3N5O and a molecular weight of 295.22 g/mol. Its IUPAC name is 2-[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]oxybenzonitrile.
| Compound Name | 2-[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 106776357 |
| Molecular Formula | C12H8F3N5O |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-[6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-yl]oxybenzonitrile |
| SMILES | N#Cc1ccccc1Oc1cc(NN)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H8F3N5O/c13-12(14,15)11-18-9(20-17)5-10(19-11)21-8-4-2-1-3-7(8)6-16/h1-5H,17H2,(H,18,19,20) |
| InChIKey | CMEMZOJWGKPYDU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|