C18H28N2O — CID 106778270
N-ethyl-4-[(2,4,6-trimethylphenyl)methyl]piperidine-2-carboxamide (PubChem CID 106778270) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is N-ethyl-4-[(2,4,6-trimethylphenyl)methyl]piperidine-2-carboxamide.
| Compound Name | N-ethyl-4-[(2,4,6-trimethylphenyl)methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 106778270 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | N-ethyl-4-[(2,4,6-trimethylphenyl)methyl]piperidine-2-carboxamide |
| SMILES | CCNC(=O)C1CC(Cc2c(C)cc(C)cc2C)CCN1 |
| InChI | InChI=1S/C18H28N2O/c1-5-19-18(21)17-11-15(6-7-20-17)10-16-13(3)8-12(2)9-14(16)4/h8-9,15,17,20H,5-7,10-11H2,1-4H3,(H,19,21) |
| InChIKey | LGORRFJDSGUQIJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |