C13H15N3 — CID 106779086
4-(2-methylpyrazol-3-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 106779086) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-(2-methylpyrazol-3-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 4-(2-methylpyrazol-3-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106779086 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 4-(2-methylpyrazol-3-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | Cn1nccc1C1CCNc2ccccc21 |
| InChI | InChI=1S/C13H15N3/c1-16-13(7-9-15-16)11-6-8-14-12-5-3-2-4-10(11)12/h2-5,7,9,11,14H,6,8H2,1H3 |
| InChIKey | OWTACPWPYJQGOD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |