About 2-(trifluoromethyl)-6-(3,3,3-trifluoropropyl)piperidine
2-(trifluoromethyl)-6-(3,3,3-trifluoropropyl)piperidine (PubChem CID 106779737) has the molecular formula C9H13F6N
and a molecular weight of 249.20 g/mol. Its IUPAC name is 2-(trifluoromethyl)-6-(3,3,3-trifluoropropyl)piperidine.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)-6-(3,3,3-trifluoropropyl)piperidine |
| PubChem CID | 106779737 |
| Molecular Formula | C9H13F6N |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-(trifluoromethyl)-6-(3,3,3-trifluoropropyl)piperidine |
| SMILES | FC(F)(F)CCC1CCCC(C(F)(F)F)N1 |
| InChI | InChI=1S/C9H13F6N/c10-8(11,12)5-4-6-2-1-3-7(16-6)9(13,14)15/h6-7,16H,1-5H2 |
| InChIKey | CUKKBVINLWYALJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(trifluoromethyl)-6-(3,3,3-trifluoropropyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)-6-(3,3,3-trifluoropropyl)piperidine?
The IUPAC name of 2-(trifluoromethyl)-6-(3,3,3-trifluoropropyl)piperidine (CID 106779737) is 2-(trifluoromethyl)-6-(3,3,3-trifluoropropyl)piperidine.
What is the SMILES notation for 2-(trifluoromethyl)-6-(3,3,3-trifluoropropyl)piperidine?
The canonical SMILES for 2-(trifluoromethyl)-6-(3,3,3-trifluoropropyl)piperidine is FC(F)(F)CCC1CCCC(C(F)(F)F)N1.
What is the InChIKey of 2-(trifluoromethyl)-6-(3,3,3-trifluoropropyl)piperidine?
The InChIKey is CUKKBVINLWYALJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F6N/c10-8(11,12)5-4-6-2-1-3-7(16-6)9(13,14)15/h6-7,16H,1-5H2.
What are the key properties of 2-(trifluoromethyl)-6-(3,3,3-trifluoropropyl)piperidine?
2-(trifluoromethyl)-6-(3,3,3-trifluoropropyl)piperidine has a molecular weight of 249.20 g/mol, XLogP of 3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)-6-(3,3,3-trifluoropropyl)piperidine is sourced from PubChem (CID 106779737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).