C17H23NO2 — CID 106780797
3-(2,6-dioxaspiro[4.5]decan-9-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 106780797) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-(2,6-dioxaspiro[4.5]decan-9-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 3-(2,6-dioxaspiro[4.5]decan-9-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106780797 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 3-(2,6-dioxaspiro[4.5]decan-9-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc2c(c1)CC(C1CCOC3(CCOC3)C1)CN2 |
| InChI | InChI=1S/C17H23NO2/c1-2-4-16-13(3-1)9-15(11-18-16)14-5-7-20-17(10-14)6-8-19-12-17/h1-4,14-15,18H,5-12H2 |
| InChIKey | JINXCVZRGPRYQP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |