C18H27NO — CID 106781632
3-methyl-2-(2,2,5,5-tetramethyloxolan-3-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 106781632) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 3-methyl-2-(2,2,5,5-tetramethyloxolan-3-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 3-methyl-2-(2,2,5,5-tetramethyloxolan-3-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106781632 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 3-methyl-2-(2,2,5,5-tetramethyloxolan-3-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1Cc2ccccc2NC1C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C18H27NO/c1-12-10-13-8-6-7-9-15(13)19-16(12)14-11-17(2,3)20-18(14,4)5/h6-9,12,14,16,19H,10-11H2,1-5H3 |
| InChIKey | UVLZPNFDLUWTBG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |