C17H25NO — CID 106781898
2-(2-methoxy-4,6-dimethylphenyl)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine (PubChem CID 106781898) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-(2-methoxy-4,6-dimethylphenyl)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine.
| Compound Name | 2-(2-methoxy-4,6-dimethylphenyl)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 106781898 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2-(2-methoxy-4,6-dimethylphenyl)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine |
| SMILES | COc1cc(C)cc(C)c1C1CCC2CCCC2N1 |
| InChI | InChI=1S/C17H25NO/c1-11-9-12(2)17(16(10-11)19-3)15-8-7-13-5-4-6-14(13)18-15/h9-10,13-15,18H,4-8H2,1-3H3 |
| InChIKey | YCPBVUQIRLPPIG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |