About 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]tricyclo[5.2.1.02,6]decan-8-ol
8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]tricyclo[5.2.1.02,6]decan-8-ol (PubChem CID 106781955) has the molecular formula C14H16F3NOS
and a molecular weight of 303.35 g/mol. Its IUPAC name is 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]tricyclo[5.2.1.02,6]decan-8-ol.
Molecular Properties
| Compound Name | 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]tricyclo[5.2.1.02,6]decan-8-ol |
| PubChem CID | 106781955 |
| Molecular Formula | C14H16F3NOS |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]tricyclo[5.2.1.02,6]decan-8-ol |
| SMILES | OC1(c2cnc(C(F)(F)F)s2)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C14H16F3NOS/c15-14(16,17)12-18-6-11(20-12)13(19)5-7-4-10(13)9-3-1-2-8(7)9/h6-10,19H,1-5H2 |
| InChIKey | RMVGYYOGNGJMTC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]tricyclo[5.2.1.02,6]decan-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]tricyclo[5.2.1.02,6]decan-8-ol?
The IUPAC name of 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]tricyclo[5.2.1.02,6]decan-8-ol (CID 106781955) is 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]tricyclo[5.2.1.02,6]decan-8-ol.
What is the SMILES notation for 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]tricyclo[5.2.1.02,6]decan-8-ol?
The canonical SMILES for 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]tricyclo[5.2.1.02,6]decan-8-ol is OC1(c2cnc(C(F)(F)F)s2)CC2CC1C1CCCC21.
What is the InChIKey of 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]tricyclo[5.2.1.02,6]decan-8-ol?
The InChIKey is RMVGYYOGNGJMTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F3NOS/c15-14(16,17)12-18-6-11(20-12)13(19)5-7-4-10(13)9-3-1-2-8(7)9/h6-10,19H,1-5H2.
What are the key properties of 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]tricyclo[5.2.1.02,6]decan-8-ol?
8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]tricyclo[5.2.1.02,6]decan-8-ol has a molecular weight of 303.35 g/mol, XLogP of 3.81, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[2-(trifluoromethyl)-1,3-thiazol-5-yl]tricyclo[5.2.1.02,6]decan-8-ol is sourced from PubChem (CID 106781955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).