About 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopentan-1-ol
1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopentan-1-ol (PubChem CID 106781956) has the molecular formula C9H10F3NOS
and a molecular weight of 237.25 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopentan-1-ol |
| PubChem CID | 106781956 |
| Molecular Formula | C9H10F3NOS |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopentan-1-ol |
| SMILES | OC1(c2cnc(C(F)(F)F)s2)CCCC1 |
| InChI | InChI=1S/C9H10F3NOS/c10-9(11,12)7-13-5-6(15-7)8(14)3-1-2-4-8/h5,14H,1-4H2 |
| InChIKey | LZYIDWVUKFWDLM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopentan-1-ol?
The IUPAC name of 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopentan-1-ol (CID 106781956) is 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopentan-1-ol.
What is the SMILES notation for 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopentan-1-ol?
The canonical SMILES for 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopentan-1-ol is OC1(c2cnc(C(F)(F)F)s2)CCCC1.
What is the InChIKey of 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopentan-1-ol?
The InChIKey is LZYIDWVUKFWDLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3NOS/c10-9(11,12)7-13-5-6(15-7)8(14)3-1-2-4-8/h5,14H,1-4H2.
What are the key properties of 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopentan-1-ol?
1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopentan-1-ol has a molecular weight of 237.25 g/mol, XLogP of 2.92, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclopentan-1-ol is sourced from PubChem (CID 106781956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).