About (3-methylcyclohexyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol
(3-methylcyclohexyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol (PubChem CID 106782157) has the molecular formula C12H16F3NOS
and a molecular weight of 279.33 g/mol. Its IUPAC name is (3-methylcyclohexyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol.
Molecular Properties
| Compound Name | (3-methylcyclohexyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol |
| PubChem CID | 106782157 |
| Molecular Formula | C12H16F3NOS |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (3-methylcyclohexyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol |
| SMILES | CC1CCCC(C(O)c2cnc(C(F)(F)F)s2)C1 |
| InChI | InChI=1S/C12H16F3NOS/c1-7-3-2-4-8(5-7)10(17)9-6-16-11(18-9)12(13,14)15/h6-8,10,17H,2-5H2,1H3 |
| InChIKey | NTUAPWKWOQTZNU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methylcyclohexyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylcyclohexyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol?
The IUPAC name of (3-methylcyclohexyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol (CID 106782157) is (3-methylcyclohexyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol.
What is the SMILES notation for (3-methylcyclohexyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol?
The canonical SMILES for (3-methylcyclohexyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol is CC1CCCC(C(O)c2cnc(C(F)(F)F)s2)C1.
What is the InChIKey of (3-methylcyclohexyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol?
The InChIKey is NTUAPWKWOQTZNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3NOS/c1-7-3-2-4-8(5-7)10(17)9-6-16-11(18-9)12(13,14)15/h6-8,10,17H,2-5H2,1H3.
What are the key properties of (3-methylcyclohexyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol?
(3-methylcyclohexyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol has a molecular weight of 279.33 g/mol, XLogP of 4.02, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylcyclohexyl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanol is sourced from PubChem (CID 106782157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).