C4H6N2O2 — CID 10678217
5,5,6,6-tetradeuterio-1,3-diazinane-2,4-dione (PubChem CID 10678217) has the molecular formula C4H6N2O2 and a molecular weight of 118.13 g/mol. Its IUPAC name is 5,5,6,6-tetradeuterio-1,3-diazinane-2,4-dione.
| Compound Name | 5,5,6,6-tetradeuterio-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 10678217 |
| Molecular Formula | C4H6N2O2 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | 5,5,6,6-tetradeuterio-1,3-diazinane-2,4-dione |
| SMILES | [2H]C1([2H])NC(=O)NC(=O)C1([2H])[2H] |
| InChI | InChI=1S/C4H6N2O2/c7-3-1-2-5-4(8)6-3/h1-2H2,(H2,5,6,7,8)/i1D2,2D2 |
| InChIKey | OIVLITBTBDPEFK-LNLMKGTHSA-N |
| XLogP | -0.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |