C9H11F3N2OS — CID 106782368
4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]oxan-4-amine (PubChem CID 106782368) has the molecular formula C9H11F3N2OS and a molecular weight of 252.26 g/mol. Its IUPAC name is 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]oxan-4-amine.
| Compound Name | 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]oxan-4-amine |
|---|---|
| PubChem CID | 106782368 |
| Molecular Formula | C9H11F3N2OS |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]oxan-4-amine |
| SMILES | NC1(c2cnc(C(F)(F)F)s2)CCOCC1 |
| InChI | InChI=1S/C9H11F3N2OS/c10-9(11,12)7-14-5-6(16-7)8(13)1-3-15-4-2-8/h5H,1-4,13H2 |
| InChIKey | IOGYAMOLBHJYKG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |