About pyrimidin-4-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone
pyrimidin-4-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone (PubChem CID 106782495) has the molecular formula C9H4F3N3OS
and a molecular weight of 259.21 g/mol. Its IUPAC name is pyrimidin-4-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone.
Molecular Properties
| Compound Name | pyrimidin-4-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
| PubChem CID | 106782495 |
| Molecular Formula | C9H4F3N3OS |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | pyrimidin-4-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1ccncn1)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H4F3N3OS/c10-9(11,12)8-14-3-6(17-8)7(16)5-1-2-13-4-15-5/h1-4H |
| InChIKey | LCDCBTODQALLTL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pyrimidin-4-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimidin-4-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone?
The IUPAC name of pyrimidin-4-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone (CID 106782495) is pyrimidin-4-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone.
What is the SMILES notation for pyrimidin-4-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone?
The canonical SMILES for pyrimidin-4-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone is O=C(c1ccncn1)c1cnc(C(F)(F)F)s1.
What is the InChIKey of pyrimidin-4-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone?
The InChIKey is LCDCBTODQALLTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F3N3OS/c10-9(11,12)8-14-3-6(17-8)7(16)5-1-2-13-4-15-5/h1-4H.
What are the key properties of pyrimidin-4-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone?
pyrimidin-4-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone has a molecular weight of 259.21 g/mol, XLogP of 2.18, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimidin-4-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone is sourced from PubChem (CID 106782495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).