C12H13F3N2O2S — CID 106782573
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone (PubChem CID 106782573) has the molecular formula C12H13F3N2O2S and a molecular weight of 306.31 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 106782573 |
| Molecular Formula | C12H13F3N2O2S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1cnc(C(F)(F)F)s1)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C12H13F3N2O2S/c13-12(14,15)11-16-4-9(20-11)10(18)8-5-17-3-1-2-7(17)6-19-8/h4,7-8H,1-3,5-6H2 |
| InChIKey | BXTQQVNCVMEFMM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |