About methyl oxolane-3-carboxylate
methyl oxolane-3-carboxylate (PubChem CID 10678263) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is methyl oxolane-3-carboxylate.
Molecular Properties
| Compound Name | methyl oxolane-3-carboxylate |
| PubChem CID | 10678263 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | methyl oxolane-3-carboxylate |
| SMILES | COC(=O)C1CCOC1 |
| InChI | InChI=1S/C6H10O3/c1-8-6(7)5-2-3-9-4-5/h5H,2-4H2,1H3 |
| InChIKey | HUTNCRJHLZDGPO-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl oxolane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl oxolane-3-carboxylate?
The IUPAC name of methyl oxolane-3-carboxylate (CID 10678263) is methyl oxolane-3-carboxylate.
What is the SMILES notation for methyl oxolane-3-carboxylate?
The canonical SMILES for methyl oxolane-3-carboxylate is COC(=O)C1CCOC1.
What is the InChIKey of methyl oxolane-3-carboxylate?
The InChIKey is HUTNCRJHLZDGPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3/c1-8-6(7)5-2-3-9-4-5/h5H,2-4H2,1H3.
What are the key properties of methyl oxolane-3-carboxylate?
methyl oxolane-3-carboxylate has a molecular weight of 130.14 g/mol, XLogP of 0.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl oxolane-3-carboxylate is sourced from PubChem (CID 10678263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).