C9H13F3N2S — CID 106783466
1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pentan-1-amine (PubChem CID 106783466) has the molecular formula C9H13F3N2S and a molecular weight of 238.28 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pentan-1-amine.
| Compound Name | 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pentan-1-amine |
|---|---|
| PubChem CID | 106783466 |
| Molecular Formula | C9H13F3N2S |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]pentan-1-amine |
| SMILES | CCCCC(N)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H13F3N2S/c1-2-3-4-6(13)7-5-14-8(15-7)9(10,11)12/h5-6H,2-4,13H2,1H3 |
| InChIKey | JBWRHSDOHWPXHQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |