About 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-yn-2-amine
4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-yn-2-amine (PubChem CID 106783833) has the molecular formula C8H7F3N2S
and a molecular weight of 220.22 g/mol. Its IUPAC name is 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-yn-2-amine.
Molecular Properties
| Compound Name | 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-yn-2-amine |
| PubChem CID | 106783833 |
| Molecular Formula | C8H7F3N2S |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-yn-2-amine |
| SMILES | CC(N)C#Cc1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C8H7F3N2S/c1-5(12)2-3-6-4-13-7(14-6)8(9,10)11/h4-5H,12H2,1H3 |
| InChIKey | MBHXQVLWNOXWSB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-yn-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-yn-2-amine?
The IUPAC name of 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-yn-2-amine (CID 106783833) is 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-yn-2-amine.
What is the SMILES notation for 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-yn-2-amine?
The canonical SMILES for 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-yn-2-amine is CC(N)C#Cc1cnc(C(F)(F)F)s1.
What is the InChIKey of 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-yn-2-amine?
The InChIKey is MBHXQVLWNOXWSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3N2S/c1-5(12)2-3-6-4-13-7(14-6)8(9,10)11/h4-5H,12H2,1H3.
What are the key properties of 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-yn-2-amine?
4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-yn-2-amine has a molecular weight of 220.22 g/mol, XLogP of 1.86, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(trifluoromethyl)-1,3-thiazol-5-yl]but-3-yn-2-amine is sourced from PubChem (CID 106783833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).