About methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexanoate
methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexanoate (PubChem CID 106784041) has the molecular formula C11H14F3NO2S
and a molecular weight of 281.30 g/mol. Its IUPAC name is methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexanoate.
Molecular Properties
| Compound Name | methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexanoate |
| PubChem CID | 106784041 |
| Molecular Formula | C11H14F3NO2S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexanoate |
| SMILES | CCCCC(C(=O)OC)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C11H14F3NO2S/c1-3-4-5-7(9(16)17-2)8-6-15-10(18-8)11(12,13)14/h6-7H,3-5H2,1-2H3 |
| InChIKey | SNBGJTXLDXBMAK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexanoate?
The IUPAC name of methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexanoate (CID 106784041) is methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexanoate.
What is the SMILES notation for methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexanoate?
The canonical SMILES for methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexanoate is CCCCC(C(=O)OC)c1cnc(C(F)(F)F)s1.
What is the InChIKey of methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexanoate?
The InChIKey is SNBGJTXLDXBMAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3NO2S/c1-3-4-5-7(9(16)17-2)8-6-15-10(18-8)11(12,13)14/h6-7H,3-5H2,1-2H3.
What are the key properties of methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexanoate?
methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexanoate has a molecular weight of 281.30 g/mol, XLogP of 3.61, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]hexanoate is sourced from PubChem (CID 106784041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).