About 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-one
3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-one (PubChem CID 106784116) has the molecular formula C10H10F3NOS
and a molecular weight of 249.26 g/mol. Its IUPAC name is 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-one.
Molecular Properties
| Compound Name | 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-one |
| PubChem CID | 106784116 |
| Molecular Formula | C10H10F3NOS |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-one |
| SMILES | O=C1CCCC(c2cnc(C(F)(F)F)s2)C1 |
| InChI | InChI=1S/C10H10F3NOS/c11-10(12,13)9-14-5-8(16-9)6-2-1-3-7(15)4-6/h5-6H,1-4H2 |
| InChIKey | WCZGEAINZGMWLR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-one?
The IUPAC name of 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-one (CID 106784116) is 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-one.
What is the SMILES notation for 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-one?
The canonical SMILES for 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-one is O=C1CCCC(c2cnc(C(F)(F)F)s2)C1.
What is the InChIKey of 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-one?
The InChIKey is WCZGEAINZGMWLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NOS/c11-10(12,13)9-14-5-8(16-9)6-2-1-3-7(15)4-6/h5-6H,1-4H2.
What are the key properties of 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-one?
3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-one has a molecular weight of 249.26 g/mol, XLogP of 3.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-one is sourced from PubChem (CID 106784116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).