C10H10F3NOS — CID 106784213
3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohex-2-en-1-ol (PubChem CID 106784213) has the molecular formula C10H10F3NOS and a molecular weight of 249.26 g/mol. Its IUPAC name is 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohex-2-en-1-ol.
| Compound Name | 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 106784213 |
| Molecular Formula | C10H10F3NOS |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]cyclohex-2-en-1-ol |
| SMILES | OC1C=C(c2cnc(C(F)(F)F)s2)CCC1 |
| InChI | InChI=1S/C10H10F3NOS/c11-10(12,13)9-14-5-8(16-9)6-2-1-3-7(15)4-6/h4-5,7,15H,1-3H2 |
| InChIKey | JNBSTTGODMBBKN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |