About 4-ethoxy-2-methyl-2,3-dihydro-1H-pyridin-6-one
4-ethoxy-2-methyl-2,3-dihydro-1H-pyridin-6-one (PubChem CID 10678456) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is 4-ethoxy-2-methyl-2,3-dihydro-1H-pyridin-6-one.
Molecular Properties
| Compound Name | 4-ethoxy-2-methyl-2,3-dihydro-1H-pyridin-6-one |
| PubChem CID | 10678456 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 4-ethoxy-2-methyl-2,3-dihydro-1H-pyridin-6-one |
| SMILES | CCOC1=CC(=O)NC(C)C1 |
| InChI | InChI=1S/C8H13NO2/c1-3-11-7-4-6(2)9-8(10)5-7/h5-6H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | NLJUTUPZAZZXID-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethoxy-2-methyl-2,3-dihydro-1H-pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-2-methyl-2,3-dihydro-1H-pyridin-6-one?
The IUPAC name of 4-ethoxy-2-methyl-2,3-dihydro-1H-pyridin-6-one (CID 10678456) is 4-ethoxy-2-methyl-2,3-dihydro-1H-pyridin-6-one.
What is the SMILES notation for 4-ethoxy-2-methyl-2,3-dihydro-1H-pyridin-6-one?
The canonical SMILES for 4-ethoxy-2-methyl-2,3-dihydro-1H-pyridin-6-one is CCOC1=CC(=O)NC(C)C1.
What is the InChIKey of 4-ethoxy-2-methyl-2,3-dihydro-1H-pyridin-6-one?
The InChIKey is NLJUTUPZAZZXID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2/c1-3-11-7-4-6(2)9-8(10)5-7/h5-6H,3-4H2,1-2H3,(H,9,10).
What are the key properties of 4-ethoxy-2-methyl-2,3-dihydro-1H-pyridin-6-one?
4-ethoxy-2-methyl-2,3-dihydro-1H-pyridin-6-one has a molecular weight of 155.20 g/mol, XLogP of 0.82, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-2-methyl-2,3-dihydro-1H-pyridin-6-one is sourced from PubChem (CID 10678456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).