C9H7F3N2OS — CID 106784740
2-(prop-2-ynylamino)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone (PubChem CID 106784740) has the molecular formula C9H7F3N2OS and a molecular weight of 248.23 g/mol. Its IUPAC name is 2-(prop-2-ynylamino)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 2-(prop-2-ynylamino)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 106784740 |
| Molecular Formula | C9H7F3N2OS |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 2-(prop-2-ynylamino)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone |
| SMILES | C#CCNCC(=O)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H7F3N2OS/c1-2-3-13-4-6(15)7-5-14-8(16-7)9(10,11)12/h1,5,13H,3-4H2 |
| InChIKey | QSJSYHXVCIHVJW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|