About (1,3-diethylpyrazol-5-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone
(1,3-diethylpyrazol-5-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone (PubChem CID 106784823) has the molecular formula C12H12F3N3OS
and a molecular weight of 303.31 g/mol. Its IUPAC name is (1,3-diethylpyrazol-5-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone.
Molecular Properties
| Compound Name | (1,3-diethylpyrazol-5-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
| PubChem CID | 106784823 |
| Molecular Formula | C12H12F3N3OS |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (1,3-diethylpyrazol-5-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
| SMILES | CCc1cc(C(=O)c2cnc(C(F)(F)F)s2)n(CC)n1 |
| InChI | InChI=1S/C12H12F3N3OS/c1-3-7-5-8(18(4-2)17-7)10(19)9-6-16-11(20-9)12(13,14)15/h5-6H,3-4H2,1-2H3 |
| InChIKey | UHESDWQWYFZJTF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1,3-diethylpyrazol-5-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-diethylpyrazol-5-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone?
The IUPAC name of (1,3-diethylpyrazol-5-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone (CID 106784823) is (1,3-diethylpyrazol-5-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone.
What is the SMILES notation for (1,3-diethylpyrazol-5-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone?
The canonical SMILES for (1,3-diethylpyrazol-5-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone is CCc1cc(C(=O)c2cnc(C(F)(F)F)s2)n(CC)n1.
What is the InChIKey of (1,3-diethylpyrazol-5-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone?
The InChIKey is UHESDWQWYFZJTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F3N3OS/c1-3-7-5-8(18(4-2)17-7)10(19)9-6-16-11(20-9)12(13,14)15/h5-6H,3-4H2,1-2H3.
What are the key properties of (1,3-diethylpyrazol-5-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone?
(1,3-diethylpyrazol-5-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone has a molecular weight of 303.31 g/mol, XLogP of 3.17, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-diethylpyrazol-5-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone is sourced from PubChem (CID 106784823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).