About (2,5-dimethylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone
(2,5-dimethylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone (PubChem CID 106785003) has the molecular formula C10H8F3N3OS
and a molecular weight of 275.26 g/mol. Its IUPAC name is (2,5-dimethylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone.
Molecular Properties
| Compound Name | (2,5-dimethylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
| PubChem CID | 106785003 |
| Molecular Formula | C10H8F3N3OS |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | (2,5-dimethylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
| SMILES | Cc1cc(C(=O)c2cnc(C(F)(F)F)s2)n(C)n1 |
| InChI | InChI=1S/C10H8F3N3OS/c1-5-3-6(16(2)15-5)8(17)7-4-14-9(18-7)10(11,12)13/h3-4H,1-2H3 |
| InChIKey | XWWRPTQSBWFSKA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2,5-dimethylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dimethylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone?
The IUPAC name of (2,5-dimethylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone (CID 106785003) is (2,5-dimethylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone.
What is the SMILES notation for (2,5-dimethylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone?
The canonical SMILES for (2,5-dimethylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone is Cc1cc(C(=O)c2cnc(C(F)(F)F)s2)n(C)n1.
What is the InChIKey of (2,5-dimethylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone?
The InChIKey is XWWRPTQSBWFSKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3N3OS/c1-5-3-6(16(2)15-5)8(17)7-4-14-9(18-7)10(11,12)13/h3-4H,1-2H3.
What are the key properties of (2,5-dimethylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone?
(2,5-dimethylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone has a molecular weight of 275.26 g/mol, XLogP of 2.43, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dimethylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone is sourced from PubChem (CID 106785003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).