C12H10F3IN2S — CID 106785216
1-(2-iodophenyl)-N-methyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanamine (PubChem CID 106785216) has the molecular formula C12H10F3IN2S and a molecular weight of 398.19 g/mol. Its IUPAC name is 1-(2-iodophenyl)-N-methyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanamine.
| Compound Name | 1-(2-iodophenyl)-N-methyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 106785216 |
| Molecular Formula | C12H10F3IN2S |
| Molecular Weight | 398.19 g/mol |
| Exact Mass | 397.96 |
| IUPAC Name | 1-(2-iodophenyl)-N-methyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanamine |
| SMILES | CNC(c1cnc(C(F)(F)F)s1)c1ccccc1I |
| InChI | InChI=1S/C12H10F3IN2S/c1-17-10(7-4-2-3-5-8(7)16)9-6-18-11(19-9)12(13,14)15/h2-6,10,17H,1H3 |
| InChIKey | VENMMNXWAFNCNV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.19 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|