C8H18N2O — CID 10678522
(2S,3S)-2-amino-N,N,3-trimethylpentanamide (PubChem CID 10678522) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is (2S,3S)-2-amino-N,N,3-trimethylpentanamide.
| Compound Name | (2S,3S)-2-amino-N,N,3-trimethylpentanamide |
|---|---|
| PubChem CID | 10678522 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | (2S,3S)-2-amino-N,N,3-trimethylpentanamide |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N(C)C |
| InChI | InChI=1S/C8H18N2O/c1-5-6(2)7(9)8(11)10(3)4/h6-7H,5,9H2,1-4H3/t6-,7-/m0/s1 |
| InChIKey | BBURRWZXFUJMSZ-BQBZGAKWSA-N |
| XLogP | 0.45 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |