C14H10F3N3S — CID 106785673
quinolin-5-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanamine (PubChem CID 106785673) has the molecular formula C14H10F3N3S and a molecular weight of 309.32 g/mol. Its IUPAC name is quinolin-5-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanamine.
| Compound Name | quinolin-5-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 106785673 |
| Molecular Formula | C14H10F3N3S |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | quinolin-5-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanamine |
| SMILES | NC(c1cnc(C(F)(F)F)s1)c1cccc2ncccc12 |
| InChI | InChI=1S/C14H10F3N3S/c15-14(16,17)13-20-7-11(21-13)12(18)9-3-1-5-10-8(9)4-2-6-19-10/h1-7,12H,18H2 |
| InChIKey | GATMGHZHWBJCSK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |