C15H25F3N2S — CID 106786044
N-ethyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]nonan-1-amine (PubChem CID 106786044) has the molecular formula C15H25F3N2S and a molecular weight of 322.44 g/mol. Its IUPAC name is N-ethyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]nonan-1-amine.
| Compound Name | N-ethyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]nonan-1-amine |
|---|---|
| PubChem CID | 106786044 |
| Molecular Formula | C15H25F3N2S |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N-ethyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]nonan-1-amine |
| SMILES | CCCCCCCCC(NCC)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C15H25F3N2S/c1-3-5-6-7-8-9-10-12(19-4-2)13-11-20-14(21-13)15(16,17)18/h11-12,19H,3-10H2,1-2H3 |
| InChIKey | SPAXWZHEIVLQIW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|