C10H16F3N3OS — CID 106787056
[2-ethoxy-2-methyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propyl]hydrazine (PubChem CID 106787056) has the molecular formula C10H16F3N3OS and a molecular weight of 283.32 g/mol. Its IUPAC name is [2-ethoxy-2-methyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propyl]hydrazine.
| Compound Name | [2-ethoxy-2-methyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propyl]hydrazine |
|---|---|
| PubChem CID | 106787056 |
| Molecular Formula | C10H16F3N3OS |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | [2-ethoxy-2-methyl-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propyl]hydrazine |
| SMILES | CCOC(C)(C)C(NN)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C10H16F3N3OS/c1-4-17-9(2,3)7(16-14)6-5-15-8(18-6)10(11,12)13/h5,7,16H,4,14H2,1-3H3 |
| InChIKey | JFZVPERRZCFTMW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|