C14H16N4O — CID 106787213
2-methoxy-4-[[(1-methylpyrazol-4-yl)methylamino]methyl]benzonitrile (PubChem CID 106787213) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-methoxy-4-[[(1-methylpyrazol-4-yl)methylamino]methyl]benzonitrile.
| Compound Name | 2-methoxy-4-[[(1-methylpyrazol-4-yl)methylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 106787213 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-methoxy-4-[[(1-methylpyrazol-4-yl)methylamino]methyl]benzonitrile |
| SMILES | COc1cc(CNCc2cnn(C)c2)ccc1C#N |
| InChI | InChI=1S/C14H16N4O/c1-18-10-12(9-17-18)8-16-7-11-3-4-13(6-15)14(5-11)19-2/h3-5,9-10,16H,7-8H2,1-2H3 |
| InChIKey | SJZCUQWXDONTFN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |