About 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-4-one
2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-4-one (PubChem CID 106787600) has the molecular formula C9H5F3N2OS
and a molecular weight of 246.21 g/mol. Its IUPAC name is 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-4-one |
| PubChem CID | 106787600 |
| Molecular Formula | C9H5F3N2OS |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-4-one |
| SMILES | O=c1cc[nH]c(-c2cnc(C(F)(F)F)s2)c1 |
| InChI | InChI=1S/C9H5F3N2OS/c10-9(11,12)8-14-4-7(16-8)6-3-5(15)1-2-13-6/h1-4H,(H,13,15) |
| InChIKey | BGHMQARENDKCNX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-4-one?
The IUPAC name of 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-4-one (CID 106787600) is 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-4-one.
What is the SMILES notation for 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-4-one?
The canonical SMILES for 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-4-one is O=c1cc[nH]c(-c2cnc(C(F)(F)F)s2)c1.
What is the InChIKey of 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-4-one?
The InChIKey is BGHMQARENDKCNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F3N2OS/c10-9(11,12)8-14-4-7(16-8)6-3-5(15)1-2-13-6/h1-4H,(H,13,15).
What are the key properties of 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-4-one?
2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-4-one has a molecular weight of 246.21 g/mol, XLogP of 2.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]-1H-pyridin-4-one is sourced from PubChem (CID 106787600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).