C9H13FO2 — CID 10678777
1-[(1S,3R,5S,6S)-5-fluoro-6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl]ethanone (PubChem CID 10678777) has the molecular formula C9H13FO2 and a molecular weight of 172.20 g/mol. Its IUPAC name is 1-[(1S,3R,5S,6S)-5-fluoro-6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl]ethanone.
| Compound Name | 1-[(1S,3R,5S,6S)-5-fluoro-6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl]ethanone |
|---|---|
| PubChem CID | 10678777 |
| Molecular Formula | C9H13FO2 |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 1-[(1S,3R,5S,6S)-5-fluoro-6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl]ethanone |
| SMILES | CC(=O)[C@@H]1C[C@@H]2O[C@]2(C)[C@@H](F)C1 |
| InChI | InChI=1S/C9H13FO2/c1-5(11)6-3-7(10)9(2)8(4-6)12-9/h6-8H,3-4H2,1-2H3/t6-,7-,8-,9+/m0/s1 |
| InChIKey | MBVZEZNQTRAAFB-XSPKLOCKSA-N |
| XLogP | 1.48 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|