C18H18N2O — CID 106787989
4-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-methoxybenzonitrile (PubChem CID 106787989) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-methoxybenzonitrile.
| Compound Name | 4-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 106787989 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 4-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-methoxybenzonitrile |
| SMILES | COc1cc(CN2CCCc3ccccc32)ccc1C#N |
| InChI | InChI=1S/C18H18N2O/c1-21-18-11-14(8-9-16(18)12-19)13-20-10-4-6-15-5-2-3-7-17(15)20/h2-3,5,7-9,11H,4,6,10,13H2,1H3 |
| InChIKey | GWSSWOMOGWFBBL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |