C14H19N3O2S — CID 106788878
2-methoxy-4-[(2-methyl-3-oxopiperazin-1-yl)methyl]benzenecarbothioamide (PubChem CID 106788878) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-methoxy-4-[(2-methyl-3-oxopiperazin-1-yl)methyl]benzenecarbothioamide.
| Compound Name | 2-methoxy-4-[(2-methyl-3-oxopiperazin-1-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 106788878 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-methoxy-4-[(2-methyl-3-oxopiperazin-1-yl)methyl]benzenecarbothioamide |
| SMILES | COc1cc(CN2CCNC(=O)C2C)ccc1C(N)=S |
| InChI | InChI=1S/C14H19N3O2S/c1-9-14(18)16-5-6-17(9)8-10-3-4-11(13(15)20)12(7-10)19-2/h3-4,7,9H,5-6,8H2,1-2H3,(H2,15,20)(H,16,18) |
| InChIKey | ADKBXSFQZIPEFO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|