C12H12N2O2 — CID 106789413
5-ethenyl-3-(2-methoxy-4-methylphenyl)-1,2,4-oxadiazole (PubChem CID 106789413) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 5-ethenyl-3-(2-methoxy-4-methylphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-ethenyl-3-(2-methoxy-4-methylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 106789413 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 5-ethenyl-3-(2-methoxy-4-methylphenyl)-1,2,4-oxadiazole |
| SMILES | C=Cc1nc(-c2ccc(C)cc2OC)no1 |
| InChI | InChI=1S/C12H12N2O2/c1-4-11-13-12(14-16-11)9-6-5-8(2)7-10(9)15-3/h4-7H,1H2,2-3H3 |
| InChIKey | BAZGYTGAARFVPD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |