About 5,5-dimethyl-6-oxido-4H-thieno[2,3-c]pyridin-6-ium
5,5-dimethyl-6-oxido-4H-thieno[2,3-c]pyridin-6-ium (PubChem CID 10678974) has the molecular formula C9H11NOS
and a molecular weight of 181.26 g/mol. Its IUPAC name is 5,5-dimethyl-6-oxido-4H-thieno[2,3-c]pyridin-6-ium.
Molecular Properties
| Compound Name | 5,5-dimethyl-6-oxido-4H-thieno[2,3-c]pyridin-6-ium |
| PubChem CID | 10678974 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 5,5-dimethyl-6-oxido-4H-thieno[2,3-c]pyridin-6-ium |
| SMILES | CC1(C)Cc2ccsc2C=[N+]1[O-] |
| InChI | InChI=1S/C9H11NOS/c1-9(2)5-7-3-4-12-8(7)6-10(9)11/h3-4,6H,5H2,1-2H3 |
| InChIKey | JGAHEKWZRFCOQA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-6-oxido-4H-thieno[2,3-c]pyridin-6-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-6-oxido-4H-thieno[2,3-c]pyridin-6-ium?
The IUPAC name of 5,5-dimethyl-6-oxido-4H-thieno[2,3-c]pyridin-6-ium (CID 10678974) is 5,5-dimethyl-6-oxido-4H-thieno[2,3-c]pyridin-6-ium.
What is the SMILES notation for 5,5-dimethyl-6-oxido-4H-thieno[2,3-c]pyridin-6-ium?
The canonical SMILES for 5,5-dimethyl-6-oxido-4H-thieno[2,3-c]pyridin-6-ium is CC1(C)Cc2ccsc2C=[N+]1[O-].
What is the InChIKey of 5,5-dimethyl-6-oxido-4H-thieno[2,3-c]pyridin-6-ium?
The InChIKey is JGAHEKWZRFCOQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NOS/c1-9(2)5-7-3-4-12-8(7)6-10(9)11/h3-4,6H,5H2,1-2H3.
What are the key properties of 5,5-dimethyl-6-oxido-4H-thieno[2,3-c]pyridin-6-ium?
5,5-dimethyl-6-oxido-4H-thieno[2,3-c]pyridin-6-ium has a molecular weight of 181.26 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-6-oxido-4H-thieno[2,3-c]pyridin-6-ium is sourced from PubChem (CID 10678974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).