C15H19BrN2O3 — CID 106790609
[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(2-methoxy-4-methylphenyl)methanol (PubChem CID 106790609) has the molecular formula C15H19BrN2O3 and a molecular weight of 355.23 g/mol. Its IUPAC name is [4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(2-methoxy-4-methylphenyl)methanol.
| Compound Name | [4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(2-methoxy-4-methylphenyl)methanol |
|---|---|
| PubChem CID | 106790609 |
| Molecular Formula | C15H19BrN2O3 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | [4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(2-methoxy-4-methylphenyl)methanol |
| SMILES | COCCn1ncc(Br)c1C(O)c1ccc(C)cc1OC |
| InChI | InChI=1S/C15H19BrN2O3/c1-10-4-5-11(13(8-10)21-3)15(19)14-12(16)9-17-18(14)6-7-20-2/h4-5,8-9,15,19H,6-7H2,1-3H3 |
| InChIKey | GPXRLYCAAHJLDY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |