C11H20O2 — CID 10679063
(E,1R)-1-[(2R,3S)-3-pentyloxiran-2-yl]but-2-en-1-ol (PubChem CID 10679063) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (E,1R)-1-[(2R,3S)-3-pentyloxiran-2-yl]but-2-en-1-ol.
| Compound Name | (E,1R)-1-[(2R,3S)-3-pentyloxiran-2-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 10679063 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (E,1R)-1-[(2R,3S)-3-pentyloxiran-2-yl]but-2-en-1-ol |
| SMILES | C/C=C/[C@@H](O)[C@H]1O[C@H]1CCCCC |
| InChI | InChI=1S/C11H20O2/c1-3-5-6-8-10-11(13-10)9(12)7-4-2/h4,7,9-12H,3,5-6,8H2,1-2H3/b7-4+/t9-,10+,11-/m1/s1 |
| InChIKey | RTUGNVMMUMIJBK-FBMKYFCMSA-N |
| XLogP | 2.27 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|