C17H20N2O2 — CID 106791193
4-[(2,4-dimethylphenoxy)methyl]-2-methoxybenzenecarboximidamide (PubChem CID 106791193) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-[(2,4-dimethylphenoxy)methyl]-2-methoxybenzenecarboximidamide.
| Compound Name | 4-[(2,4-dimethylphenoxy)methyl]-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 106791193 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 4-[(2,4-dimethylphenoxy)methyl]-2-methoxybenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(COc2ccc(C)cc2C)cc1OC |
| InChI | InChI=1S/C17H20N2O2/c1-11-4-7-15(12(2)8-11)21-10-13-5-6-14(17(18)19)16(9-13)20-3/h4-9H,10H2,1-3H3,(H3,18,19) |
| InChIKey | VOWPKZOUTWFASM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|