C12H13NO — CID 10679141
(1R,2S,6R,7R,8R)-11-oxotricyclo[5.3.1.02,6]undec-9-ene-8-carbonitrile (PubChem CID 10679141) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is (1R,2S,6R,7R,8R)-11-oxotricyclo[5.3.1.02,6]undec-9-ene-8-carbonitrile.
| Compound Name | (1R,2S,6R,7R,8R)-11-oxotricyclo[5.3.1.02,6]undec-9-ene-8-carbonitrile |
|---|---|
| PubChem CID | 10679141 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | (1R,2S,6R,7R,8R)-11-oxotricyclo[5.3.1.02,6]undec-9-ene-8-carbonitrile |
| SMILES | N#C[C@@H]1C=C[C@H]2C(=O)[C@@H]1[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C12H13NO/c13-6-7-4-5-10-8-2-1-3-9(8)11(7)12(10)14/h4-5,7-11H,1-3H2/t7-,8-,9+,10+,11-/m0/s1 |
| InChIKey | CXZABWLVZLEWDS-DAWVFNFOSA-N |
| XLogP | 1.93 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|