About 4-methoxy-6-methyl-2-(1,2,4-triazol-1-yl)pyrimidine
4-methoxy-6-methyl-2-(1,2,4-triazol-1-yl)pyrimidine (PubChem CID 10679259) has the molecular formula C8H9N5O
and a molecular weight of 191.19 g/mol. Its IUPAC name is 4-methoxy-6-methyl-2-(1,2,4-triazol-1-yl)pyrimidine.
Molecular Properties
| Compound Name | 4-methoxy-6-methyl-2-(1,2,4-triazol-1-yl)pyrimidine |
| PubChem CID | 10679259 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 4-methoxy-6-methyl-2-(1,2,4-triazol-1-yl)pyrimidine |
| SMILES | COc1cc(C)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C8H9N5O/c1-6-3-7(14-2)12-8(11-6)13-5-9-4-10-13/h3-5H,1-2H3 |
| InChIKey | HLVKQBZLEAKKJG-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-methoxy-6-methyl-2-(1,2,4-triazol-1-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-6-methyl-2-(1,2,4-triazol-1-yl)pyrimidine?
The IUPAC name of 4-methoxy-6-methyl-2-(1,2,4-triazol-1-yl)pyrimidine (CID 10679259) is 4-methoxy-6-methyl-2-(1,2,4-triazol-1-yl)pyrimidine.
What is the SMILES notation for 4-methoxy-6-methyl-2-(1,2,4-triazol-1-yl)pyrimidine?
The canonical SMILES for 4-methoxy-6-methyl-2-(1,2,4-triazol-1-yl)pyrimidine is COc1cc(C)nc(-n2cncn2)n1.
What is the InChIKey of 4-methoxy-6-methyl-2-(1,2,4-triazol-1-yl)pyrimidine?
The InChIKey is HLVKQBZLEAKKJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5O/c1-6-3-7(14-2)12-8(11-6)13-5-9-4-10-13/h3-5H,1-2H3.
What are the key properties of 4-methoxy-6-methyl-2-(1,2,4-triazol-1-yl)pyrimidine?
4-methoxy-6-methyl-2-(1,2,4-triazol-1-yl)pyrimidine has a molecular weight of 191.19 g/mol, XLogP of 0.37, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-6-methyl-2-(1,2,4-triazol-1-yl)pyrimidine is sourced from PubChem (CID 10679259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).