C11H12O3 — CID 10679282
(1R,2S,3S,6R,7R,9R)-11,12-dioxatetracyclo[7.2.1.13,6.02,7]tridec-4-en-8-one (PubChem CID 10679282) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is (1R,2S,3S,6R,7R,9R)-11,12-dioxatetracyclo[7.2.1.13,6.02,7]tridec-4-en-8-one.
| Compound Name | (1R,2S,3S,6R,7R,9R)-11,12-dioxatetracyclo[7.2.1.13,6.02,7]tridec-4-en-8-one |
|---|---|
| PubChem CID | 10679282 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (1R,2S,3S,6R,7R,9R)-11,12-dioxatetracyclo[7.2.1.13,6.02,7]tridec-4-en-8-one |
| SMILES | O=C1[C@H]2[C@@H]([C@@H]3OC[C@H]1O3)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C11H12O3/c12-10-7-4-13-11(14-7)9-6-2-1-5(3-6)8(9)10/h1-2,5-9,11H,3-4H2/t5-,6+,7+,8+,9-,11+/m0/s1 |
| InChIKey | UJVLBMWFHVLRIL-QPXYYRDESA-N |
| XLogP | 0.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|