C15H18N4O — CID 106793406
2-methoxy-4-[[4-[2-(methylamino)ethyl]imidazol-1-yl]methyl]benzonitrile (PubChem CID 106793406) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 2-methoxy-4-[[4-[2-(methylamino)ethyl]imidazol-1-yl]methyl]benzonitrile.
| Compound Name | 2-methoxy-4-[[4-[2-(methylamino)ethyl]imidazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 106793406 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-methoxy-4-[[4-[2-(methylamino)ethyl]imidazol-1-yl]methyl]benzonitrile |
| SMILES | CNCCc1cn(Cc2ccc(C#N)c(OC)c2)cn1 |
| InChI | InChI=1S/C15H18N4O/c1-17-6-5-14-10-19(11-18-14)9-12-3-4-13(8-16)15(7-12)20-2/h3-4,7,10-11,17H,5-6,9H2,1-2H3 |
| InChIKey | ORSVQCXAJYZZPB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |