C11H14O3 — CID 10679348
(2R,3R,4S)-2,4-dihydroxy-3-prop-2-enyl-3,4,5,6-tetrahydro-2H-pentalen-1-one (PubChem CID 10679348) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (2R,3R,4S)-2,4-dihydroxy-3-prop-2-enyl-3,4,5,6-tetrahydro-2H-pentalen-1-one.
| Compound Name | (2R,3R,4S)-2,4-dihydroxy-3-prop-2-enyl-3,4,5,6-tetrahydro-2H-pentalen-1-one |
|---|---|
| PubChem CID | 10679348 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (2R,3R,4S)-2,4-dihydroxy-3-prop-2-enyl-3,4,5,6-tetrahydro-2H-pentalen-1-one |
| SMILES | C=CC[C@@H]1C2=C(CC[C@@H]2O)C(=O)[C@@H]1O |
| InChI | InChI=1S/C11H14O3/c1-2-3-6-9-7(4-5-8(9)12)11(14)10(6)13/h2,6,8,10,12-13H,1,3-5H2/t6-,8+,10-/m1/s1 |
| InChIKey | WRTJJSJPZOTENC-KDILMLJESA-N |
| XLogP | 0.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|