About 4-(aminomethyl)-3-N,5-N-diethylpyridine-3,5-diamine
4-(aminomethyl)-3-N,5-N-diethylpyridine-3,5-diamine (PubChem CID 10679361) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-(aminomethyl)-3-N,5-N-diethylpyridine-3,5-diamine.
Molecular Properties
| Compound Name | 4-(aminomethyl)-3-N,5-N-diethylpyridine-3,5-diamine |
| PubChem CID | 10679361 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 4-(aminomethyl)-3-N,5-N-diethylpyridine-3,5-diamine |
| SMILES | CCNc1cncc(NCC)c1CN |
| InChI | InChI=1S/C10H18N4/c1-3-13-9-6-12-7-10(14-4-2)8(9)5-11/h6-7,13-14H,3-5,11H2,1-2H3 |
| InChIKey | SKGYFTATZNKEGD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(aminomethyl)-3-N,5-N-diethylpyridine-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-3-N,5-N-diethylpyridine-3,5-diamine?
The IUPAC name of 4-(aminomethyl)-3-N,5-N-diethylpyridine-3,5-diamine (CID 10679361) is 4-(aminomethyl)-3-N,5-N-diethylpyridine-3,5-diamine.
What is the SMILES notation for 4-(aminomethyl)-3-N,5-N-diethylpyridine-3,5-diamine?
The canonical SMILES for 4-(aminomethyl)-3-N,5-N-diethylpyridine-3,5-diamine is CCNc1cncc(NCC)c1CN.
What is the InChIKey of 4-(aminomethyl)-3-N,5-N-diethylpyridine-3,5-diamine?
The InChIKey is SKGYFTATZNKEGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4/c1-3-13-9-6-12-7-10(14-4-2)8(9)5-11/h6-7,13-14H,3-5,11H2,1-2H3.
What are the key properties of 4-(aminomethyl)-3-N,5-N-diethylpyridine-3,5-diamine?
4-(aminomethyl)-3-N,5-N-diethylpyridine-3,5-diamine has a molecular weight of 194.28 g/mol, XLogP of 1.40, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-3-N,5-N-diethylpyridine-3,5-diamine is sourced from PubChem (CID 10679361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).