C11H22OSi — CID 10679483
(2R,4R)-2,4-dimethyl-6-trimethylsilylhex-5-yn-1-ol (PubChem CID 10679483) has the molecular formula C11H22OSi and a molecular weight of 198.38 g/mol. Its IUPAC name is (2R,4R)-2,4-dimethyl-6-trimethylsilylhex-5-yn-1-ol.
| Compound Name | (2R,4R)-2,4-dimethyl-6-trimethylsilylhex-5-yn-1-ol |
|---|---|
| PubChem CID | 10679483 |
| Molecular Formula | C11H22OSi |
| Molecular Weight | 198.38 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (2R,4R)-2,4-dimethyl-6-trimethylsilylhex-5-yn-1-ol |
| SMILES | C[C@@H](CO)C[C@@H](C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C11H22OSi/c1-10(8-11(2)9-12)6-7-13(3,4)5/h10-12H,8-9H2,1-5H3/t10-,11+/m0/s1 |
| InChIKey | BUPDYCVTVGBKNM-WDEREUQCSA-N |
| XLogP | 2.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|